C14H17Br — CID 175229717
2-bromo-4,8-dimethyl-1,2,3,5,6,7-hexahydro-s-indacene (PubChem CID 175229717) has the molecular formula C14H17Br and a molecular weight of 265.19 g/mol. Its IUPAC name is 2-bromo-4,8-dimethyl-1,2,3,5,6,7-hexahydro-s-indacene.
| Compound Name | 2-bromo-4,8-dimethyl-1,2,3,5,6,7-hexahydro-s-indacene |
|---|---|
| PubChem CID | 175229717 |
| Molecular Formula | C14H17Br |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 2-bromo-4,8-dimethyl-1,2,3,5,6,7-hexahydro-s-indacene |
| SMILES | Cc1c2c(c(C)c3c1CC(Br)C3)CCC2 |
| InChI | InChI=1S/C14H17Br/c1-8-11-4-3-5-12(11)9(2)14-7-10(15)6-13(8)14/h10H,3-7H2,1-2H3 |
| InChIKey | UXZRTNZXVXEOIZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|