About [1-(6-benzylsulfanyl-3,5-dicyano-4-ethyl-2-pyridinyl)piperidin-4-yl] carbamate
[1-(6-benzylsulfanyl-3,5-dicyano-4-ethyl-2-pyridinyl)piperidin-4-yl] carbamate (PubChem CID 175231239) has the molecular formula C22H23N5O2S
and a molecular weight of 421.53 g/mol. Its IUPAC name is [1-(6-benzylsulfanyl-3,5-dicyano-4-ethyl-2-pyridinyl)piperidin-4-yl] carbamate.
Molecular Properties
| Compound Name | [1-(6-benzylsulfanyl-3,5-dicyano-4-ethyl-2-pyridinyl)piperidin-4-yl] carbamate |
| PubChem CID | 175231239 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [1-(6-benzylsulfanyl-3,5-dicyano-4-ethyl-2-pyridinyl)piperidin-4-yl] carbamate |
| SMILES | CCc1c(C#N)c(SCc2ccccc2)nc(N2CCC(OC(N)=O)CC2)c1C#N |
| InChI | InChI=1S/C22H23N5O2S/c1-2-17-18(12-23)20(27-10-8-16(9-11-27)29-22(25)28)26-21(19(17)13-24)30-14-15-6-4-3-5-7-15/h3-7,16H,2,8-11,14H2,1H3,(H2,25,28) |
| InChIKey | YRBIEXWPBPJLSM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-(6-benzylsulfanyl-3,5-dicyano-4-ethyl-2-pyridinyl)piperidin-4-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(6-benzylsulfanyl-3,5-dicyano-4-ethyl-2-pyridinyl)piperidin-4-yl] carbamate?
The IUPAC name of [1-(6-benzylsulfanyl-3,5-dicyano-4-ethyl-2-pyridinyl)piperidin-4-yl] carbamate (CID 175231239) is [1-(6-benzylsulfanyl-3,5-dicyano-4-ethyl-2-pyridinyl)piperidin-4-yl] carbamate.
What is the SMILES notation for [1-(6-benzylsulfanyl-3,5-dicyano-4-ethyl-2-pyridinyl)piperidin-4-yl] carbamate?
The canonical SMILES for [1-(6-benzylsulfanyl-3,5-dicyano-4-ethyl-2-pyridinyl)piperidin-4-yl] carbamate is CCc1c(C#N)c(SCc2ccccc2)nc(N2CCC(OC(N)=O)CC2)c1C#N.
What is the InChIKey of [1-(6-benzylsulfanyl-3,5-dicyano-4-ethyl-2-pyridinyl)piperidin-4-yl] carbamate?
The InChIKey is YRBIEXWPBPJLSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N5O2S/c1-2-17-18(12-23)20(27-10-8-16(9-11-27)29-22(25)28)26-21(19(17)13-24)30-14-15-6-4-3-5-7-15/h3-7,16H,2,8-11,14H2,1H3,(H2,25,28).
What are the key properties of [1-(6-benzylsulfanyl-3,5-dicyano-4-ethyl-2-pyridinyl)piperidin-4-yl] carbamate?
[1-(6-benzylsulfanyl-3,5-dicyano-4-ethyl-2-pyridinyl)piperidin-4-yl] carbamate has a molecular weight of 421.53 g/mol, XLogP of 3.74, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(6-benzylsulfanyl-3,5-dicyano-4-ethyl-2-pyridinyl)piperidin-4-yl] carbamate is sourced from PubChem (CID 175231239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).