About 3-[1-[3-(2,2,2-trifluoroacetyl)oxypropyl]piperazin-1-ium-1-yl]propane-1-sulfonate
3-[1-[3-(2,2,2-trifluoroacetyl)oxypropyl]piperazin-1-ium-1-yl]propane-1-sulfonate (PubChem CID 175231478) has the molecular formula C12H21F3N2O5S
and a molecular weight of 362.37 g/mol. Its IUPAC name is 3-[1-[3-(2,2,2-trifluoroacetyl)oxypropyl]piperazin-1-ium-1-yl]propane-1-sulfonate.
Molecular Properties
| Compound Name | 3-[1-[3-(2,2,2-trifluoroacetyl)oxypropyl]piperazin-1-ium-1-yl]propane-1-sulfonate |
| PubChem CID | 175231478 |
| Molecular Formula | C12H21F3N2O5S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 3-[1-[3-(2,2,2-trifluoroacetyl)oxypropyl]piperazin-1-ium-1-yl]propane-1-sulfonate |
| SMILES | O=C(OCCC[N+]1(CCCS(=O)(=O)[O-])CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C12H21F3N2O5S/c13-12(14,15)11(18)22-9-1-5-17(7-3-16-4-8-17)6-2-10-23(19,20)21/h16H,1-10H2 |
| InChIKey | RQOJVRFWYNLKEC-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-[3-(2,2,2-trifluoroacetyl)oxypropyl]piperazin-1-ium-1-yl]propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[3-(2,2,2-trifluoroacetyl)oxypropyl]piperazin-1-ium-1-yl]propane-1-sulfonate?
The IUPAC name of 3-[1-[3-(2,2,2-trifluoroacetyl)oxypropyl]piperazin-1-ium-1-yl]propane-1-sulfonate (CID 175231478) is 3-[1-[3-(2,2,2-trifluoroacetyl)oxypropyl]piperazin-1-ium-1-yl]propane-1-sulfonate.
What is the SMILES notation for 3-[1-[3-(2,2,2-trifluoroacetyl)oxypropyl]piperazin-1-ium-1-yl]propane-1-sulfonate?
The canonical SMILES for 3-[1-[3-(2,2,2-trifluoroacetyl)oxypropyl]piperazin-1-ium-1-yl]propane-1-sulfonate is O=C(OCCC[N+]1(CCCS(=O)(=O)[O-])CCNCC1)C(F)(F)F.
What is the InChIKey of 3-[1-[3-(2,2,2-trifluoroacetyl)oxypropyl]piperazin-1-ium-1-yl]propane-1-sulfonate?
The InChIKey is RQOJVRFWYNLKEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F3N2O5S/c13-12(14,15)11(18)22-9-1-5-17(7-3-16-4-8-17)6-2-10-23(19,20)21/h16H,1-10H2.
What are the key properties of 3-[1-[3-(2,2,2-trifluoroacetyl)oxypropyl]piperazin-1-ium-1-yl]propane-1-sulfonate?
3-[1-[3-(2,2,2-trifluoroacetyl)oxypropyl]piperazin-1-ium-1-yl]propane-1-sulfonate has a molecular weight of 362.37 g/mol, XLogP of -0.16, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[3-(2,2,2-trifluoroacetyl)oxypropyl]piperazin-1-ium-1-yl]propane-1-sulfonate is sourced from PubChem (CID 175231478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).