C11H15NO6S — CID 175231524
[2-hydroxy-3-(3-methylsulfonylphenoxy)propyl] carbamate (PubChem CID 175231524) has the molecular formula C11H15NO6S and a molecular weight of 289.31 g/mol. Its IUPAC name is [2-hydroxy-3-(3-methylsulfonylphenoxy)propyl] carbamate.
| Compound Name | [2-hydroxy-3-(3-methylsulfonylphenoxy)propyl] carbamate |
|---|---|
| PubChem CID | 175231524 |
| Molecular Formula | C11H15NO6S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | [2-hydroxy-3-(3-methylsulfonylphenoxy)propyl] carbamate |
| SMILES | CS(=O)(=O)c1cccc(OCC(O)COC(N)=O)c1 |
| InChI | InChI=1S/C11H15NO6S/c1-19(15,16)10-4-2-3-9(5-10)17-6-8(13)7-18-11(12)14/h2-5,8,13H,6-7H2,1H3,(H2,12,14) |
| InChIKey | KFWATLYOTFIBRO-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |