About methylphosphonic acid;phenol
methylphosphonic acid;phenol (PubChem CID 175231709) has the molecular formula C13H17O5P
and a molecular weight of 284.25 g/mol. Its IUPAC name is methylphosphonic acid;phenol.
Molecular Properties
| Compound Name | methylphosphonic acid;phenol |
| PubChem CID | 175231709 |
| Molecular Formula | C13H17O5P |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | methylphosphonic acid;phenol |
| SMILES | CP(=O)(O)O.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/2C6H6O.CH5O3P/c2*7-6-4-2-1-3-5-6;1-5(2,3)4/h2*1-5,7H;1H3,(H2,2,3,4) |
| InChIKey | MFHYCZJOTRYKKI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methylphosphonic acid;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylphosphonic acid;phenol?
The IUPAC name of methylphosphonic acid;phenol (CID 175231709) is methylphosphonic acid;phenol.
What is the SMILES notation for methylphosphonic acid;phenol?
The canonical SMILES for methylphosphonic acid;phenol is CP(=O)(O)O.Oc1ccccc1.Oc1ccccc1.
What is the InChIKey of methylphosphonic acid;phenol?
The InChIKey is MFHYCZJOTRYKKI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H6O.CH5O3P/c2*7-6-4-2-1-3-5-6;1-5(2,3)4/h2*1-5,7H;1H3,(H2,2,3,4).
What are the key properties of methylphosphonic acid;phenol?
methylphosphonic acid;phenol has a molecular weight of 284.25 g/mol, XLogP of 2.58, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylphosphonic acid;phenol is sourced from PubChem (CID 175231709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).