C34H36N2O5 — CID 175232302
ethyl 2-[5-[2-[(4-methoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-5-yl]-5-(4-nitrophenyl)cyclohexa-1,3-dien-1-yl]propanoate (PubChem CID 175232302) has the molecular formula C34H36N2O5 and a molecular weight of 552.67 g/mol. Its IUPAC name is ethyl 2-[5-[2-[(4-methoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-5-yl]-5-(4-nitrophenyl)cyclohexa-1,3-dien-1-yl]propanoate.
| Compound Name | ethyl 2-[5-[2-[(4-methoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-5-yl]-5-(4-nitrophenyl)cyclohexa-1,3-dien-1-yl]propanoate |
|---|---|
| PubChem CID | 175232302 |
| Molecular Formula | C34H36N2O5 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | ethyl 2-[5-[2-[(4-methoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-5-yl]-5-(4-nitrophenyl)cyclohexa-1,3-dien-1-yl]propanoate |
| SMILES | CCOC(=O)C(C)C1=CC=CC(c2ccc([N+](=O)[O-])cc2)(c2cccc3c2CCN(Cc2ccc(OC)cc2)C3)C1 |
| InChI | InChI=1S/C34H36N2O5/c1-4-41-33(37)24(2)26-8-6-19-34(21-26,28-12-14-29(15-13-28)36(38)39)32-9-5-7-27-23-35(20-18-31(27)32)22-25-10-16-30(40-3)17-11-25/h5-17,19,24H,4,18,20-23H2,1-3H3 |
| InChIKey | YOAAUTONKVRNRY-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|