C40H47N5O3 — CID 175232510
2,3,4-trimethyl-5-[7-[(3R)-3-(3-morpholin-4-ylpropyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1,2,3,4-tetrahydroisoquinolin-6-yl]-N-phenylpyrrole-1-carboxamide (PubChem CID 175232510) has the molecular formula C40H47N5O3 and a molecular weight of 645.85 g/mol. Its IUPAC name is 2,3,4-trimethyl-5-[7-[(3R)-3-(3-morpholin-4-ylpropyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1,2,3,4-tetrahydroisoquinolin-6-yl]-N-phenylpyrrole-1-carboxamide.
| Compound Name | 2,3,4-trimethyl-5-[7-[(3R)-3-(3-morpholin-4-ylpropyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1,2,3,4-tetrahydroisoquinolin-6-yl]-N-phenylpyrrole-1-carboxamide |
|---|---|
| PubChem CID | 175232510 |
| Molecular Formula | C40H47N5O3 |
| Molecular Weight | 645.85 g/mol |
| Exact Mass | 645.37 |
| IUPAC Name | 2,3,4-trimethyl-5-[7-[(3R)-3-(3-morpholin-4-ylpropyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1,2,3,4-tetrahydroisoquinolin-6-yl]-N-phenylpyrrole-1-carboxamide |
| SMILES | Cc1c(C)c(-c2cc3c(cc2C(=O)N2Cc4ccccc4C[C@H]2CCCN2CCOCC2)CNCC3)n(C(=O)Nc2ccccc2)c1C |
| InChI | InChI=1S/C40H47N5O3/c1-27-28(2)38(45(29(27)3)40(47)42-34-12-5-4-6-13-34)36-23-31-15-16-41-25-33(31)24-37(36)39(46)44-26-32-11-8-7-10-30(32)22-35(44)14-9-17-43-18-20-48-21-19-43/h4-8,10-13,23-24,35,41H,9,14-22,25-26H2,1-3H3,(H,42,47)/t35-/m1/s1 |
| InChIKey | QMXBDQYFMPGFSU-PGUFJCEWSA-N |
| XLogP | 6.49 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.85 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |