About cyclopenta-2,4-dien-1-ylmethanol;dichlorotitanium;methanone
cyclopenta-2,4-dien-1-ylmethanol;dichlorotitanium;methanone (PubChem CID 175233340) has the molecular formula C7H9Cl2O2Ti-
and a molecular weight of 243.92 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-ylmethanol;dichlorotitanium;methanone.
Molecular Properties
| Compound Name | cyclopenta-2,4-dien-1-ylmethanol;dichlorotitanium;methanone |
| PubChem CID | 175233340 |
| Molecular Formula | C7H9Cl2O2Ti- |
| Molecular Weight | 243.92 g/mol |
| Exact Mass | 242.95 |
| IUPAC Name | cyclopenta-2,4-dien-1-ylmethanol;dichlorotitanium;methanone |
| SMILES | Cl[Ti]Cl.OCC1C=CC=C1.[CH-]=O |
| InChI | InChI=1S/C6H8O.CHO.2ClH.Ti/c7-5-6-3-1-2-4-6;1-2;;;/h1-4,6-7H,5H2;1H;2*1H;/q;-1;;;+2/p-2 |
| InChIKey | DXZOYPLIXMLGCX-UHFFFAOYSA-L |
| XLogP | 1.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.92 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-2,4-dien-1-ylmethanol;dichlorotitanium;methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-2,4-dien-1-ylmethanol;dichlorotitanium;methanone?
The IUPAC name of cyclopenta-2,4-dien-1-ylmethanol;dichlorotitanium;methanone (CID 175233340) is cyclopenta-2,4-dien-1-ylmethanol;dichlorotitanium;methanone.
What is the SMILES notation for cyclopenta-2,4-dien-1-ylmethanol;dichlorotitanium;methanone?
The canonical SMILES for cyclopenta-2,4-dien-1-ylmethanol;dichlorotitanium;methanone is Cl[Ti]Cl.OCC1C=CC=C1.[CH-]=O.
What is the InChIKey of cyclopenta-2,4-dien-1-ylmethanol;dichlorotitanium;methanone?
The InChIKey is DXZOYPLIXMLGCX-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H8O.CHO.2ClH.Ti/c7-5-6-3-1-2-4-6;1-2;;;/h1-4,6-7H,5H2;1H;2*1H;/q;-1;;;+2/p-2.
What are the key properties of cyclopenta-2,4-dien-1-ylmethanol;dichlorotitanium;methanone?
cyclopenta-2,4-dien-1-ylmethanol;dichlorotitanium;methanone has a molecular weight of 243.92 g/mol, XLogP of 1.82, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-2,4-dien-1-ylmethanol;dichlorotitanium;methanone is sourced from PubChem (CID 175233340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).