C21H29NO — CID 175233459
2-[1-(2-ethylphenyl)ethyl]-3-(pyridin-3-ylmethyl)pentan-1-ol (PubChem CID 175233459) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is 2-[1-(2-ethylphenyl)ethyl]-3-(pyridin-3-ylmethyl)pentan-1-ol.
| Compound Name | 2-[1-(2-ethylphenyl)ethyl]-3-(pyridin-3-ylmethyl)pentan-1-ol |
|---|---|
| PubChem CID | 175233459 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 2-[1-(2-ethylphenyl)ethyl]-3-(pyridin-3-ylmethyl)pentan-1-ol |
| SMILES | CCc1ccccc1C(C)C(CO)C(CC)Cc1cccnc1 |
| InChI | InChI=1S/C21H29NO/c1-4-18-10-6-7-11-20(18)16(3)21(15-23)19(5-2)13-17-9-8-12-22-14-17/h6-12,14,16,19,21,23H,4-5,13,15H2,1-3H3 |
| InChIKey | SEOVXUUFSVNRFE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |