C15H30O2 — CID 175233978
3-(3-methylbutyl)-1,2-dioxacyclododecane (PubChem CID 175233978) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is 3-(3-methylbutyl)-1,2-dioxacyclododecane.
| Compound Name | 3-(3-methylbutyl)-1,2-dioxacyclododecane |
|---|---|
| PubChem CID | 175233978 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 3-(3-methylbutyl)-1,2-dioxacyclododecane |
| SMILES | CC(C)CCC1CCCCCCCCCOO1 |
| InChI | InChI=1S/C15H30O2/c1-14(2)11-12-15-10-8-6-4-3-5-7-9-13-16-17-15/h14-15H,3-13H2,1-2H3 |
| InChIKey | VQWHHJDBHLNCFT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|