About hexane-1,1-diol;1-methylpyrrolidin-2-one
hexane-1,1-diol;1-methylpyrrolidin-2-one (PubChem CID 175234334) has the molecular formula C11H23NO3
and a molecular weight of 217.31 g/mol. Its IUPAC name is hexane-1,1-diol;1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | hexane-1,1-diol;1-methylpyrrolidin-2-one |
| PubChem CID | 175234334 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | hexane-1,1-diol;1-methylpyrrolidin-2-one |
| SMILES | CCCCCC(O)O.CN1CCCC1=O |
| InChI | InChI=1S/C6H14O2.C5H9NO/c1-2-3-4-5-6(7)8;1-6-4-2-3-5(6)7/h6-8H,2-5H2,1H3;2-4H2,1H3 |
| InChIKey | IQGAFMPIBFGONV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze hexane-1,1-diol;1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane-1,1-diol;1-methylpyrrolidin-2-one?
The IUPAC name of hexane-1,1-diol;1-methylpyrrolidin-2-one (CID 175234334) is hexane-1,1-diol;1-methylpyrrolidin-2-one.
What is the SMILES notation for hexane-1,1-diol;1-methylpyrrolidin-2-one?
The canonical SMILES for hexane-1,1-diol;1-methylpyrrolidin-2-one is CCCCCC(O)O.CN1CCCC1=O.
What is the InChIKey of hexane-1,1-diol;1-methylpyrrolidin-2-one?
The InChIKey is IQGAFMPIBFGONV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.C5H9NO/c1-2-3-4-5-6(7)8;1-6-4-2-3-5(6)7/h6-8H,2-5H2,1H3;2-4H2,1H3.
What are the key properties of hexane-1,1-diol;1-methylpyrrolidin-2-one?
hexane-1,1-diol;1-methylpyrrolidin-2-one has a molecular weight of 217.31 g/mol, XLogP of 1.12, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexane-1,1-diol;1-methylpyrrolidin-2-one is sourced from PubChem (CID 175234334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).