C26H33N5O4 — CID 175236746
2-[4-[[(4-amino-6,7-dimethoxyquinazolin-2-yl)-methylamino]methyl]-4-phenylpiperidin-1-yl]-3-hydroxypropanal (PubChem CID 175236746) has the molecular formula C26H33N5O4 and a molecular weight of 479.58 g/mol. Its IUPAC name is 2-[4-[[(4-amino-6,7-dimethoxyquinazolin-2-yl)-methylamino]methyl]-4-phenylpiperidin-1-yl]-3-hydroxypropanal.
| Compound Name | 2-[4-[[(4-amino-6,7-dimethoxyquinazolin-2-yl)-methylamino]methyl]-4-phenylpiperidin-1-yl]-3-hydroxypropanal |
|---|---|
| PubChem CID | 175236746 |
| Molecular Formula | C26H33N5O4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 2-[4-[[(4-amino-6,7-dimethoxyquinazolin-2-yl)-methylamino]methyl]-4-phenylpiperidin-1-yl]-3-hydroxypropanal |
| SMILES | COc1cc2nc(N(C)CC3(c4ccccc4)CCN(C(C=O)CO)CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C26H33N5O4/c1-30(25-28-21-14-23(35-3)22(34-2)13-20(21)24(27)29-25)17-26(18-7-5-4-6-8-18)9-11-31(12-10-26)19(15-32)16-33/h4-8,13-15,19,33H,9-12,16-17H2,1-3H3,(H2,27,28,29) |
| InChIKey | YOAJKQRCAGACGN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|