C18H17BrClF3N4O5S — CID 175237462
[2-(3-aminopropylsulfamoyl)-6-[(2-bromophenyl)carbamoylamino]-3-chlorophenyl] 2,2,2-trifluoroacetate (PubChem CID 175237462) has the molecular formula C18H17BrClF3N4O5S and a molecular weight of 573.78 g/mol. Its IUPAC name is [2-(3-aminopropylsulfamoyl)-6-[(2-bromophenyl)carbamoylamino]-3-chlorophenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-(3-aminopropylsulfamoyl)-6-[(2-bromophenyl)carbamoylamino]-3-chlorophenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 175237462 |
| Molecular Formula | C18H17BrClF3N4O5S |
| Molecular Weight | 573.78 g/mol |
| Exact Mass | 571.97 |
| IUPAC Name | [2-(3-aminopropylsulfamoyl)-6-[(2-bromophenyl)carbamoylamino]-3-chlorophenyl] 2,2,2-trifluoroacetate |
| SMILES | NCCCNS(=O)(=O)c1c(Cl)ccc(NC(=O)Nc2ccccc2Br)c1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C18H17BrClF3N4O5S/c19-10-4-1-2-5-12(10)26-17(29)27-13-7-6-11(20)15(33(30,31)25-9-3-8-24)14(13)32-16(28)18(21,22)23/h1-2,4-7,25H,3,8-9,24H2,(H2,26,27,29) |
| InChIKey | TWYNXOKBBKDKNZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.78 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|