About trifluoromethanesulfonamide;triphenylphosphane
trifluoromethanesulfonamide;triphenylphosphane (PubChem CID 175237720) has the molecular formula C19H17F3NO2PS
and a molecular weight of 411.39 g/mol. Its IUPAC name is trifluoromethanesulfonamide;triphenylphosphane.
Molecular Properties
| Compound Name | trifluoromethanesulfonamide;triphenylphosphane |
| PubChem CID | 175237720 |
| Molecular Formula | C19H17F3NO2PS |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | trifluoromethanesulfonamide;triphenylphosphane |
| SMILES | NS(=O)(=O)C(F)(F)F.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.CH2F3NO2S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)8(5,6)7/h1-15H;(H2,5,6,7) |
| InChIKey | SPSDZERECGSRHY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze trifluoromethanesulfonamide;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoromethanesulfonamide;triphenylphosphane?
The IUPAC name of trifluoromethanesulfonamide;triphenylphosphane (CID 175237720) is trifluoromethanesulfonamide;triphenylphosphane.
What is the SMILES notation for trifluoromethanesulfonamide;triphenylphosphane?
The canonical SMILES for trifluoromethanesulfonamide;triphenylphosphane is NS(=O)(=O)C(F)(F)F.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of trifluoromethanesulfonamide;triphenylphosphane?
The InChIKey is SPSDZERECGSRHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.CH2F3NO2S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)8(5,6)7/h1-15H;(H2,5,6,7).
What are the key properties of trifluoromethanesulfonamide;triphenylphosphane?
trifluoromethanesulfonamide;triphenylphosphane has a molecular weight of 411.39 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoromethanesulfonamide;triphenylphosphane is sourced from PubChem (CID 175237720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).