About 4-methyl-1,4-bis(methylamino)cyclohexa-2,5-diene-1-carbaldehyde
4-methyl-1,4-bis(methylamino)cyclohexa-2,5-diene-1-carbaldehyde (PubChem CID 175238315) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-methyl-1,4-bis(methylamino)cyclohexa-2,5-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-methyl-1,4-bis(methylamino)cyclohexa-2,5-diene-1-carbaldehyde |
| PubChem CID | 175238315 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 4-methyl-1,4-bis(methylamino)cyclohexa-2,5-diene-1-carbaldehyde |
| SMILES | CNC1(C)C=CC(C=O)(NC)C=C1 |
| InChI | InChI=1S/C10H16N2O/c1-9(11-2)4-6-10(8-13,12-3)7-5-9/h4-8,11-12H,1-3H3 |
| InChIKey | FFGTUXIKHQAXTQ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1,4-bis(methylamino)cyclohexa-2,5-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,4-bis(methylamino)cyclohexa-2,5-diene-1-carbaldehyde?
The IUPAC name of 4-methyl-1,4-bis(methylamino)cyclohexa-2,5-diene-1-carbaldehyde (CID 175238315) is 4-methyl-1,4-bis(methylamino)cyclohexa-2,5-diene-1-carbaldehyde.
What is the SMILES notation for 4-methyl-1,4-bis(methylamino)cyclohexa-2,5-diene-1-carbaldehyde?
The canonical SMILES for 4-methyl-1,4-bis(methylamino)cyclohexa-2,5-diene-1-carbaldehyde is CNC1(C)C=CC(C=O)(NC)C=C1.
What is the InChIKey of 4-methyl-1,4-bis(methylamino)cyclohexa-2,5-diene-1-carbaldehyde?
The InChIKey is FFGTUXIKHQAXTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-9(11-2)4-6-10(8-13,12-3)7-5-9/h4-8,11-12H,1-3H3.
What are the key properties of 4-methyl-1,4-bis(methylamino)cyclohexa-2,5-diene-1-carbaldehyde?
4-methyl-1,4-bis(methylamino)cyclohexa-2,5-diene-1-carbaldehyde has a molecular weight of 180.25 g/mol, XLogP of 0.25, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,4-bis(methylamino)cyclohexa-2,5-diene-1-carbaldehyde is sourced from PubChem (CID 175238315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).