About alumane;3-hydroperoxydioxiran-3-ol
alumane;3-hydroperoxydioxiran-3-ol (PubChem CID 175238595) has the molecular formula CH5AlO5
and a molecular weight of 124.03 g/mol. Its IUPAC name is alumane;3-hydroperoxydioxiran-3-ol.
Molecular Properties
| Compound Name | alumane;3-hydroperoxydioxiran-3-ol |
| PubChem CID | 175238595 |
| Molecular Formula | CH5AlO5 |
| Molecular Weight | 124.03 g/mol |
| Exact Mass | 124.00 |
| IUPAC Name | alumane;3-hydroperoxydioxiran-3-ol |
| SMILES | OOC1(O)OO1.[AlH3] |
| InChI | InChI=1S/CH2O5.Al.3H/c2-1(4-3)5-6-1;;;;/h2-3H;;;; |
| InChIKey | PVZFBYNIBZKUCU-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.03 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze alumane;3-hydroperoxydioxiran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;3-hydroperoxydioxiran-3-ol?
The IUPAC name of alumane;3-hydroperoxydioxiran-3-ol (CID 175238595) is alumane;3-hydroperoxydioxiran-3-ol.
What is the SMILES notation for alumane;3-hydroperoxydioxiran-3-ol?
The canonical SMILES for alumane;3-hydroperoxydioxiran-3-ol is OOC1(O)OO1.[AlH3].
What is the InChIKey of alumane;3-hydroperoxydioxiran-3-ol?
The InChIKey is PVZFBYNIBZKUCU-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O5.Al.3H/c2-1(4-3)5-6-1;;;;/h2-3H;;;;.
What are the key properties of alumane;3-hydroperoxydioxiran-3-ol?
alumane;3-hydroperoxydioxiran-3-ol has a molecular weight of 124.03 g/mol, XLogP of -2.14, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;3-hydroperoxydioxiran-3-ol is sourced from PubChem (CID 175238595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).