About 3-O-ethyl 1-O-(trifluoromethyl) 2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylate
3-O-ethyl 1-O-(trifluoromethyl) 2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylate (PubChem CID 175238767) has the molecular formula C12H12F4O4
and a molecular weight of 296.22 g/mol. Its IUPAC name is 3-O-ethyl 1-O-(trifluoromethyl) 2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-ethyl 1-O-(trifluoromethyl) 2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylate |
| PubChem CID | 175238767 |
| Molecular Formula | C12H12F4O4 |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 3-O-ethyl 1-O-(trifluoromethyl) 2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1=CC=CC(C)(C(=O)OC(F)(F)F)C1F |
| InChI | InChI=1S/C12H12F4O4/c1-3-19-9(17)7-5-4-6-11(2,8(7)13)10(18)20-12(14,15)16/h4-6,8H,3H2,1-2H3 |
| InChIKey | IYKJEIFJLMWAOA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-O-ethyl 1-O-(trifluoromethyl) 2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-ethyl 1-O-(trifluoromethyl) 2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylate?
The IUPAC name of 3-O-ethyl 1-O-(trifluoromethyl) 2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylate (CID 175238767) is 3-O-ethyl 1-O-(trifluoromethyl) 2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylate.
What is the SMILES notation for 3-O-ethyl 1-O-(trifluoromethyl) 2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylate?
The canonical SMILES for 3-O-ethyl 1-O-(trifluoromethyl) 2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylate is CCOC(=O)C1=CC=CC(C)(C(=O)OC(F)(F)F)C1F.
What is the InChIKey of 3-O-ethyl 1-O-(trifluoromethyl) 2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylate?
The InChIKey is IYKJEIFJLMWAOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F4O4/c1-3-19-9(17)7-5-4-6-11(2,8(7)13)10(18)20-12(14,15)16/h4-6,8H,3H2,1-2H3.
What are the key properties of 3-O-ethyl 1-O-(trifluoromethyl) 2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylate?
3-O-ethyl 1-O-(trifluoromethyl) 2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylate has a molecular weight of 296.22 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-ethyl 1-O-(trifluoromethyl) 2-fluoro-1-methylcyclohexa-3,5-diene-1,3-dicarboxylate is sourced from PubChem (CID 175238767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).