About potassium;3-(dinitromethyl)-5-nitro-1H-1,2,4-triazole;hydride
potassium;3-(dinitromethyl)-5-nitro-1H-1,2,4-triazole;hydride (PubChem CID 175238807) has the molecular formula C3H3KN6O6
and a molecular weight of 258.19 g/mol. Its IUPAC name is potassium;3-(dinitromethyl)-5-nitro-1H-1,2,4-triazole;hydride.
Molecular Properties
| Compound Name | potassium;3-(dinitromethyl)-5-nitro-1H-1,2,4-triazole;hydride |
| PubChem CID | 175238807 |
| Molecular Formula | C3H3KN6O6 |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | potassium;3-(dinitromethyl)-5-nitro-1H-1,2,4-triazole;hydride |
| SMILES | O=[N+]([O-])c1nc(C([N+](=O)[O-])[N+](=O)[O-])n[nH]1.[H-].[K+] |
| InChI | InChI=1S/C3H2N6O6.K.H/c10-7(11)2(8(12)13)1-4-3(6-5-1)9(14)15;;/h2H,(H,4,5,6);;/q;+1;-1 |
| InChIKey | NKSYUIXHZCSVLH-UHFFFAOYSA-N |
| XLogP | -3.62 |
| TPSA | 170.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium;3-(dinitromethyl)-5-nitro-1H-1,2,4-triazole;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;3-(dinitromethyl)-5-nitro-1H-1,2,4-triazole;hydride?
The IUPAC name of potassium;3-(dinitromethyl)-5-nitro-1H-1,2,4-triazole;hydride (CID 175238807) is potassium;3-(dinitromethyl)-5-nitro-1H-1,2,4-triazole;hydride.
What is the SMILES notation for potassium;3-(dinitromethyl)-5-nitro-1H-1,2,4-triazole;hydride?
The canonical SMILES for potassium;3-(dinitromethyl)-5-nitro-1H-1,2,4-triazole;hydride is O=[N+]([O-])c1nc(C([N+](=O)[O-])[N+](=O)[O-])n[nH]1.[H-].[K+].
What is the InChIKey of potassium;3-(dinitromethyl)-5-nitro-1H-1,2,4-triazole;hydride?
The InChIKey is NKSYUIXHZCSVLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2N6O6.K.H/c10-7(11)2(8(12)13)1-4-3(6-5-1)9(14)15;;/h2H,(H,4,5,6);;/q;+1;-1.
What are the key properties of potassium;3-(dinitromethyl)-5-nitro-1H-1,2,4-triazole;hydride?
potassium;3-(dinitromethyl)-5-nitro-1H-1,2,4-triazole;hydride has a molecular weight of 258.19 g/mol, XLogP of -3.62, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;3-(dinitromethyl)-5-nitro-1H-1,2,4-triazole;hydride is sourced from PubChem (CID 175238807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).