About 1-methyl-6-pentylsulfonylcyclohexa-2,4-diene-1-sulfonyl fluoride
1-methyl-6-pentylsulfonylcyclohexa-2,4-diene-1-sulfonyl fluoride (PubChem CID 175239308) has the molecular formula C12H19FO4S2
and a molecular weight of 310.41 g/mol. Its IUPAC name is 1-methyl-6-pentylsulfonylcyclohexa-2,4-diene-1-sulfonyl fluoride.
Molecular Properties
| Compound Name | 1-methyl-6-pentylsulfonylcyclohexa-2,4-diene-1-sulfonyl fluoride |
| PubChem CID | 175239308 |
| Molecular Formula | C12H19FO4S2 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 1-methyl-6-pentylsulfonylcyclohexa-2,4-diene-1-sulfonyl fluoride |
| SMILES | CCCCCS(=O)(=O)C1C=CC=CC1(C)S(=O)(=O)F |
| InChI | InChI=1S/C12H19FO4S2/c1-3-4-7-10-18(14,15)11-8-5-6-9-12(11,2)19(13,16)17/h5-6,8-9,11H,3-4,7,10H2,1-2H3 |
| InChIKey | ZWZWUGJLNILECW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-6-pentylsulfonylcyclohexa-2,4-diene-1-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-6-pentylsulfonylcyclohexa-2,4-diene-1-sulfonyl fluoride?
The IUPAC name of 1-methyl-6-pentylsulfonylcyclohexa-2,4-diene-1-sulfonyl fluoride (CID 175239308) is 1-methyl-6-pentylsulfonylcyclohexa-2,4-diene-1-sulfonyl fluoride.
What is the SMILES notation for 1-methyl-6-pentylsulfonylcyclohexa-2,4-diene-1-sulfonyl fluoride?
The canonical SMILES for 1-methyl-6-pentylsulfonylcyclohexa-2,4-diene-1-sulfonyl fluoride is CCCCCS(=O)(=O)C1C=CC=CC1(C)S(=O)(=O)F.
What is the InChIKey of 1-methyl-6-pentylsulfonylcyclohexa-2,4-diene-1-sulfonyl fluoride?
The InChIKey is ZWZWUGJLNILECW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19FO4S2/c1-3-4-7-10-18(14,15)11-8-5-6-9-12(11,2)19(13,16)17/h5-6,8-9,11H,3-4,7,10H2,1-2H3.
What are the key properties of 1-methyl-6-pentylsulfonylcyclohexa-2,4-diene-1-sulfonyl fluoride?
1-methyl-6-pentylsulfonylcyclohexa-2,4-diene-1-sulfonyl fluoride has a molecular weight of 310.41 g/mol, XLogP of 2.14, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-6-pentylsulfonylcyclohexa-2,4-diene-1-sulfonyl fluoride is sourced from PubChem (CID 175239308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).