About formic acid;1-(hydrazinylmethyl)-5-methoxycyclohexa-2,4-diene-1-carboxamide
formic acid;1-(hydrazinylmethyl)-5-methoxycyclohexa-2,4-diene-1-carboxamide (PubChem CID 175239439) has the molecular formula C10H17N3O4
and a molecular weight of 243.26 g/mol. Its IUPAC name is formic acid;1-(hydrazinylmethyl)-5-methoxycyclohexa-2,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | formic acid;1-(hydrazinylmethyl)-5-methoxycyclohexa-2,4-diene-1-carboxamide |
| PubChem CID | 175239439 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | formic acid;1-(hydrazinylmethyl)-5-methoxycyclohexa-2,4-diene-1-carboxamide |
| SMILES | COC1=CC=CC(CNN)(C(N)=O)C1.O=CO |
| InChI | InChI=1S/C9H15N3O2.CH2O2/c1-14-7-3-2-4-9(5-7,6-12-11)8(10)13;2-1-3/h2-4,12H,5-6,11H2,1H3,(H2,10,13);1H,(H,2,3) |
| InChIKey | OWXUDCWWIUQTOK-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formic acid;1-(hydrazinylmethyl)-5-methoxycyclohexa-2,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;1-(hydrazinylmethyl)-5-methoxycyclohexa-2,4-diene-1-carboxamide?
The IUPAC name of formic acid;1-(hydrazinylmethyl)-5-methoxycyclohexa-2,4-diene-1-carboxamide (CID 175239439) is formic acid;1-(hydrazinylmethyl)-5-methoxycyclohexa-2,4-diene-1-carboxamide.
What is the SMILES notation for formic acid;1-(hydrazinylmethyl)-5-methoxycyclohexa-2,4-diene-1-carboxamide?
The canonical SMILES for formic acid;1-(hydrazinylmethyl)-5-methoxycyclohexa-2,4-diene-1-carboxamide is COC1=CC=CC(CNN)(C(N)=O)C1.O=CO.
What is the InChIKey of formic acid;1-(hydrazinylmethyl)-5-methoxycyclohexa-2,4-diene-1-carboxamide?
The InChIKey is OWXUDCWWIUQTOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2.CH2O2/c1-14-7-3-2-4-9(5-7,6-12-11)8(10)13;2-1-3/h2-4,12H,5-6,11H2,1H3,(H2,10,13);1H,(H,2,3).
What are the key properties of formic acid;1-(hydrazinylmethyl)-5-methoxycyclohexa-2,4-diene-1-carboxamide?
formic acid;1-(hydrazinylmethyl)-5-methoxycyclohexa-2,4-diene-1-carboxamide has a molecular weight of 243.26 g/mol, XLogP of -0.89, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;1-(hydrazinylmethyl)-5-methoxycyclohexa-2,4-diene-1-carboxamide is sourced from PubChem (CID 175239439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).