C15H20F2N4O2 — CID 175241168
tert-butyl 3-[3-cyano-1-(difluoromethyl)pyrazol-5-yl]piperidine-1-carboxylate (PubChem CID 175241168) has the molecular formula C15H20F2N4O2 and a molecular weight of 326.35 g/mol. Its IUPAC name is tert-butyl 3-[3-cyano-1-(difluoromethyl)pyrazol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-cyano-1-(difluoromethyl)pyrazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175241168 |
| Molecular Formula | C15H20F2N4O2 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | tert-butyl 3-[3-cyano-1-(difluoromethyl)pyrazol-5-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(c2cc(C#N)nn2C(F)F)C1 |
| InChI | InChI=1S/C15H20F2N4O2/c1-15(2,3)23-14(22)20-6-4-5-10(9-20)12-7-11(8-18)19-21(12)13(16)17/h7,10,13H,4-6,9H2,1-3H3 |
| InChIKey | VJQLVJOJYCKLHA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |