About [3-(6-methyl-2-pyridinyl)piperidin-3-yl] carbamate;hydrochloride
[3-(6-methyl-2-pyridinyl)piperidin-3-yl] carbamate;hydrochloride (PubChem CID 175241184) has the molecular formula C12H18ClN3O2
and a molecular weight of 271.75 g/mol. Its IUPAC name is [3-(6-methyl-2-pyridinyl)piperidin-3-yl] carbamate;hydrochloride.
Molecular Properties
| Compound Name | [3-(6-methyl-2-pyridinyl)piperidin-3-yl] carbamate;hydrochloride |
| PubChem CID | 175241184 |
| Molecular Formula | C12H18ClN3O2 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | [3-(6-methyl-2-pyridinyl)piperidin-3-yl] carbamate;hydrochloride |
| SMILES | Cc1cccc(C2(OC(N)=O)CCCNC2)n1.Cl |
| InChI | InChI=1S/C12H17N3O2.ClH/c1-9-4-2-5-10(15-9)12(17-11(13)16)6-3-7-14-8-12;/h2,4-5,14H,3,6-8H2,1H3,(H2,13,16);1H |
| InChIKey | BMSLOKXIOKGCOB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(6-methyl-2-pyridinyl)piperidin-3-yl] carbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(6-methyl-2-pyridinyl)piperidin-3-yl] carbamate;hydrochloride?
The IUPAC name of [3-(6-methyl-2-pyridinyl)piperidin-3-yl] carbamate;hydrochloride (CID 175241184) is [3-(6-methyl-2-pyridinyl)piperidin-3-yl] carbamate;hydrochloride.
What is the SMILES notation for [3-(6-methyl-2-pyridinyl)piperidin-3-yl] carbamate;hydrochloride?
The canonical SMILES for [3-(6-methyl-2-pyridinyl)piperidin-3-yl] carbamate;hydrochloride is Cc1cccc(C2(OC(N)=O)CCCNC2)n1.Cl.
What is the InChIKey of [3-(6-methyl-2-pyridinyl)piperidin-3-yl] carbamate;hydrochloride?
The InChIKey is BMSLOKXIOKGCOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2.ClH/c1-9-4-2-5-10(15-9)12(17-11(13)16)6-3-7-14-8-12;/h2,4-5,14H,3,6-8H2,1H3,(H2,13,16);1H.
What are the key properties of [3-(6-methyl-2-pyridinyl)piperidin-3-yl] carbamate;hydrochloride?
[3-(6-methyl-2-pyridinyl)piperidin-3-yl] carbamate;hydrochloride has a molecular weight of 271.75 g/mol, XLogP of 1.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(6-methyl-2-pyridinyl)piperidin-3-yl] carbamate;hydrochloride is sourced from PubChem (CID 175241184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).