C14H15F3N2 — CID 175241563
1-butyl-2-phenyl-5-(trifluoromethyl)imidazole (PubChem CID 175241563) has the molecular formula C14H15F3N2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 1-butyl-2-phenyl-5-(trifluoromethyl)imidazole.
| Compound Name | 1-butyl-2-phenyl-5-(trifluoromethyl)imidazole |
|---|---|
| PubChem CID | 175241563 |
| Molecular Formula | C14H15F3N2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-butyl-2-phenyl-5-(trifluoromethyl)imidazole |
| SMILES | CCCCn1c(C(F)(F)F)cnc1-c1ccccc1 |
| InChI | InChI=1S/C14H15F3N2/c1-2-3-9-19-12(14(15,16)17)10-18-13(19)11-7-5-4-6-8-11/h4-8,10H,2-3,9H2,1H3 |
| InChIKey | NZURGYJIQKIOBR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |