About 2-amino-N,N-diformylacetamide
2-amino-N,N-diformylacetamide (PubChem CID 175241955) has the molecular formula C4H6N2O3
and a molecular weight of 130.10 g/mol. Its IUPAC name is 2-amino-N,N-diformylacetamide.
Molecular Properties
| Compound Name | 2-amino-N,N-diformylacetamide |
| PubChem CID | 175241955 |
| Molecular Formula | C4H6N2O3 |
| Molecular Weight | 130.10 g/mol |
| Exact Mass | 130.04 |
| IUPAC Name | 2-amino-N,N-diformylacetamide |
| SMILES | NCC(=O)N(C=O)C=O |
| InChI | InChI=1S/C4H6N2O3/c5-1-4(9)6(2-7)3-8/h2-3H,1,5H2 |
| InChIKey | SQAHBPYXJQZJPI-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.10 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N,N-diformylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N,N-diformylacetamide?
The IUPAC name of 2-amino-N,N-diformylacetamide (CID 175241955) is 2-amino-N,N-diformylacetamide.
What is the SMILES notation for 2-amino-N,N-diformylacetamide?
The canonical SMILES for 2-amino-N,N-diformylacetamide is NCC(=O)N(C=O)C=O.
What is the InChIKey of 2-amino-N,N-diformylacetamide?
The InChIKey is SQAHBPYXJQZJPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O3/c5-1-4(9)6(2-7)3-8/h2-3H,1,5H2.
What are the key properties of 2-amino-N,N-diformylacetamide?
2-amino-N,N-diformylacetamide has a molecular weight of 130.10 g/mol, XLogP of -1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N,N-diformylacetamide is sourced from PubChem (CID 175241955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).