About butyl-(3,3-dimethoxybutoxy)-dimethylsilane
butyl-(3,3-dimethoxybutoxy)-dimethylsilane (PubChem CID 175242658) has the molecular formula C12H28O3Si
and a molecular weight of 248.44 g/mol. Its IUPAC name is butyl-(3,3-dimethoxybutoxy)-dimethylsilane.
Molecular Properties
| Compound Name | butyl-(3,3-dimethoxybutoxy)-dimethylsilane |
| PubChem CID | 175242658 |
| Molecular Formula | C12H28O3Si |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | butyl-(3,3-dimethoxybutoxy)-dimethylsilane |
| SMILES | CCCC[Si](C)(C)OCCC(C)(OC)OC |
| InChI | InChI=1S/C12H28O3Si/c1-7-8-11-16(5,6)15-10-9-12(2,13-3)14-4/h7-11H2,1-6H3 |
| InChIKey | KAEZRQLPTYBZHK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze butyl-(3,3-dimethoxybutoxy)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-(3,3-dimethoxybutoxy)-dimethylsilane?
The IUPAC name of butyl-(3,3-dimethoxybutoxy)-dimethylsilane (CID 175242658) is butyl-(3,3-dimethoxybutoxy)-dimethylsilane.
What is the SMILES notation for butyl-(3,3-dimethoxybutoxy)-dimethylsilane?
The canonical SMILES for butyl-(3,3-dimethoxybutoxy)-dimethylsilane is CCCC[Si](C)(C)OCCC(C)(OC)OC.
What is the InChIKey of butyl-(3,3-dimethoxybutoxy)-dimethylsilane?
The InChIKey is KAEZRQLPTYBZHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28O3Si/c1-7-8-11-16(5,6)15-10-9-12(2,13-3)14-4/h7-11H2,1-6H3.
What are the key properties of butyl-(3,3-dimethoxybutoxy)-dimethylsilane?
butyl-(3,3-dimethoxybutoxy)-dimethylsilane has a molecular weight of 248.44 g/mol, XLogP of 3.41, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-(3,3-dimethoxybutoxy)-dimethylsilane is sourced from PubChem (CID 175242658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).