About azane;methyl 2-ethylidenepentanoate
azane;methyl 2-ethylidenepentanoate (PubChem CID 175242663) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is azane;methyl 2-ethylidenepentanoate.
Molecular Properties
| Compound Name | azane;methyl 2-ethylidenepentanoate |
| PubChem CID | 175242663 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | azane;methyl 2-ethylidenepentanoate |
| SMILES | CC=C(CCC)C(=O)OC.N |
| InChI | InChI=1S/C8H14O2.H3N/c1-4-6-7(5-2)8(9)10-3;/h5H,4,6H2,1-3H3;1H3 |
| InChIKey | JMDHOCNAJUDHHD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;methyl 2-ethylidenepentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;methyl 2-ethylidenepentanoate?
The IUPAC name of azane;methyl 2-ethylidenepentanoate (CID 175242663) is azane;methyl 2-ethylidenepentanoate.
What is the SMILES notation for azane;methyl 2-ethylidenepentanoate?
The canonical SMILES for azane;methyl 2-ethylidenepentanoate is CC=C(CCC)C(=O)OC.N.
What is the InChIKey of azane;methyl 2-ethylidenepentanoate?
The InChIKey is JMDHOCNAJUDHHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.H3N/c1-4-6-7(5-2)8(9)10-3;/h5H,4,6H2,1-3H3;1H3.
What are the key properties of azane;methyl 2-ethylidenepentanoate?
azane;methyl 2-ethylidenepentanoate has a molecular weight of 159.23 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;methyl 2-ethylidenepentanoate is sourced from PubChem (CID 175242663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).