About ethenoxy(dioctoxy)silane
ethenoxy(dioctoxy)silane (PubChem CID 175242689) has the molecular formula C18H38O3Si
and a molecular weight of 330.59 g/mol. Its IUPAC name is ethenoxy(dioctoxy)silane.
Molecular Properties
| Compound Name | ethenoxy(dioctoxy)silane |
| PubChem CID | 175242689 |
| Molecular Formula | C18H38O3Si |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | ethenoxy(dioctoxy)silane |
| SMILES | C=CO[SiH](OCCCCCCCC)OCCCCCCCC |
| InChI | InChI=1S/C18H38O3Si/c1-4-7-9-11-13-15-17-20-22(19-6-3)21-18-16-14-12-10-8-5-2/h6,22H,3-5,7-18H2,1-2H3 |
| InChIKey | ALWRFUJAUGOSIM-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenoxy(dioctoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenoxy(dioctoxy)silane?
The IUPAC name of ethenoxy(dioctoxy)silane (CID 175242689) is ethenoxy(dioctoxy)silane.
What is the SMILES notation for ethenoxy(dioctoxy)silane?
The canonical SMILES for ethenoxy(dioctoxy)silane is C=CO[SiH](OCCCCCCCC)OCCCCCCCC.
What is the InChIKey of ethenoxy(dioctoxy)silane?
The InChIKey is ALWRFUJAUGOSIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O3Si/c1-4-7-9-11-13-15-17-20-22(19-6-3)21-18-16-14-12-10-8-5-2/h6,22H,3-5,7-18H2,1-2H3.
What are the key properties of ethenoxy(dioctoxy)silane?
ethenoxy(dioctoxy)silane has a molecular weight of 330.59 g/mol, XLogP of 5.62, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenoxy(dioctoxy)silane is sourced from PubChem (CID 175242689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).