C14H13N3O4S2 — CID 175242993
[2-(1H-indazol-5-ylsulfamoyl)phenyl]methanesulfinic acid (PubChem CID 175242993) has the molecular formula C14H13N3O4S2 and a molecular weight of 351.41 g/mol. Its IUPAC name is [2-(1H-indazol-5-ylsulfamoyl)phenyl]methanesulfinic acid.
| Compound Name | [2-(1H-indazol-5-ylsulfamoyl)phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 175242993 |
| Molecular Formula | C14H13N3O4S2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | [2-(1H-indazol-5-ylsulfamoyl)phenyl]methanesulfinic acid |
| SMILES | O=S(O)Cc1ccccc1S(=O)(=O)Nc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C14H13N3O4S2/c18-22(19)9-10-3-1-2-4-14(10)23(20,21)17-12-5-6-13-11(7-12)8-15-16-13/h1-8,17H,9H2,(H,15,16)(H,18,19) |
| InChIKey | YHMZTDGZHCHATD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|