C17H29N3O3Si — CID 175243603
3-[2-tri(propan-2-yl)silyloxyacetyl]pyridine-2-carbohydrazide (PubChem CID 175243603) has the molecular formula C17H29N3O3Si and a molecular weight of 351.52 g/mol. Its IUPAC name is 3-[2-tri(propan-2-yl)silyloxyacetyl]pyridine-2-carbohydrazide.
| Compound Name | 3-[2-tri(propan-2-yl)silyloxyacetyl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 175243603 |
| Molecular Formula | C17H29N3O3Si |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 3-[2-tri(propan-2-yl)silyloxyacetyl]pyridine-2-carbohydrazide |
| SMILES | CC(C)[Si](OCC(=O)c1cccnc1C(=O)NN)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H29N3O3Si/c1-11(2)24(12(3)4,13(5)6)23-10-15(21)14-8-7-9-19-16(14)17(22)20-18/h7-9,11-13H,10,18H2,1-6H3,(H,20,22) |
| InChIKey | UAJQVFLRFVVBSV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|