About 5-chloro-1-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]indole-3-carbaldehyde
5-chloro-1-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]indole-3-carbaldehyde (PubChem CID 175243693) has the molecular formula C17H15ClN2O4S
and a molecular weight of 378.84 g/mol. Its IUPAC name is 5-chloro-1-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]indole-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-chloro-1-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]indole-3-carbaldehyde |
| PubChem CID | 175243693 |
| Molecular Formula | C17H15ClN2O4S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 5-chloro-1-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]indole-3-carbaldehyde |
| SMILES | C=CC(c1c(C)noc1C)S(=O)(=O)n1cc(C=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H15ClN2O4S/c1-4-16(17-10(2)19-24-11(17)3)25(22,23)20-8-12(9-21)14-7-13(18)5-6-15(14)20/h4-9,16H,1H2,2-3H3 |
| InChIKey | KVSKQHOHECOSIX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 82.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-1-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]indole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]indole-3-carbaldehyde?
The IUPAC name of 5-chloro-1-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]indole-3-carbaldehyde (CID 175243693) is 5-chloro-1-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]indole-3-carbaldehyde.
What is the SMILES notation for 5-chloro-1-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]indole-3-carbaldehyde?
The canonical SMILES for 5-chloro-1-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]indole-3-carbaldehyde is C=CC(c1c(C)noc1C)S(=O)(=O)n1cc(C=O)c2cc(Cl)ccc21.
What is the InChIKey of 5-chloro-1-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]indole-3-carbaldehyde?
The InChIKey is KVSKQHOHECOSIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClN2O4S/c1-4-16(17-10(2)19-24-11(17)3)25(22,23)20-8-12(9-21)14-7-13(18)5-6-15(14)20/h4-9,16H,1H2,2-3H3.
What are the key properties of 5-chloro-1-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]indole-3-carbaldehyde?
5-chloro-1-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]indole-3-carbaldehyde has a molecular weight of 378.84 g/mol, XLogP of 3.82, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-[1-(3,5-dimethyl-1,2-oxazol-4-yl)prop-2-enylsulfonyl]indole-3-carbaldehyde is sourced from PubChem (CID 175243693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).