About 2-(2,6-dimethyl-4-nitrophenyl)porphyrin
2-(2,6-dimethyl-4-nitrophenyl)porphyrin (PubChem CID 175243694) has the molecular formula C28H19N5O2
and a molecular weight of 457.49 g/mol. Its IUPAC name is 2-(2,6-dimethyl-4-nitrophenyl)porphyrin.
Molecular Properties
| Compound Name | 2-(2,6-dimethyl-4-nitrophenyl)porphyrin |
| PubChem CID | 175243694 |
| Molecular Formula | C28H19N5O2 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 2-(2,6-dimethyl-4-nitrophenyl)porphyrin |
| SMILES | Cc1cc([N+](=O)[O-])cc(C)c1C1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1 |
| InChI | InChI=1S/C28H19N5O2/c1-16-9-25(33(34)35)10-17(2)28(16)26-14-24-13-22-6-5-20(30-22)11-18-3-4-19(29-18)12-21-7-8-23(31-21)15-27(26)32-24/h3-15H,1-2H3/b18-11-,19-12-,20-11-,21-12-,22-13-,23-15-,24-13-,27-15- |
| InChIKey | COAMOUWZQRXVAJ-OILZZTAESA-N |
| XLogP | 5.63 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dimethyl-4-nitrophenyl)porphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethyl-4-nitrophenyl)porphyrin?
The IUPAC name of 2-(2,6-dimethyl-4-nitrophenyl)porphyrin (CID 175243694) is 2-(2,6-dimethyl-4-nitrophenyl)porphyrin.
What is the SMILES notation for 2-(2,6-dimethyl-4-nitrophenyl)porphyrin?
The canonical SMILES for 2-(2,6-dimethyl-4-nitrophenyl)porphyrin is Cc1cc([N+](=O)[O-])cc(C)c1C1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1.
What is the InChIKey of 2-(2,6-dimethyl-4-nitrophenyl)porphyrin?
The InChIKey is COAMOUWZQRXVAJ-OILZZTAESA-N. The full InChI is InChI=1S/C28H19N5O2/c1-16-9-25(33(34)35)10-17(2)28(16)26-14-24-13-22-6-5-20(30-22)11-18-3-4-19(29-18)12-21-7-8-23(31-21)15-27(26)32-24/h3-15H,1-2H3/b18-11-,19-12-,20-11-,21-12-,22-13-,23-15-,24-13-,27-15-.
What are the key properties of 2-(2,6-dimethyl-4-nitrophenyl)porphyrin?
2-(2,6-dimethyl-4-nitrophenyl)porphyrin has a molecular weight of 457.49 g/mol, XLogP of 5.63, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethyl-4-nitrophenyl)porphyrin is sourced from PubChem (CID 175243694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).