About 2-chloro-6-(4-fluorophenyl)pyrazine;piperidin-4-ol
2-chloro-6-(4-fluorophenyl)pyrazine;piperidin-4-ol (PubChem CID 175244850) has the molecular formula C15H17ClFN3O
and a molecular weight of 309.77 g/mol. Its IUPAC name is 2-chloro-6-(4-fluorophenyl)pyrazine;piperidin-4-ol.
Molecular Properties
| Compound Name | 2-chloro-6-(4-fluorophenyl)pyrazine;piperidin-4-ol |
| PubChem CID | 175244850 |
| Molecular Formula | C15H17ClFN3O |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-chloro-6-(4-fluorophenyl)pyrazine;piperidin-4-ol |
| SMILES | Fc1ccc(-c2cncc(Cl)n2)cc1.OC1CCNCC1 |
| InChI | InChI=1S/C10H6ClFN2.C5H11NO/c11-10-6-13-5-9(14-10)7-1-3-8(12)4-2-7;7-5-1-3-6-4-2-5/h1-6H;5-7H,1-4H2 |
| InChIKey | ZCTBQPVKETUSJQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-6-(4-fluorophenyl)pyrazine;piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-(4-fluorophenyl)pyrazine;piperidin-4-ol?
The IUPAC name of 2-chloro-6-(4-fluorophenyl)pyrazine;piperidin-4-ol (CID 175244850) is 2-chloro-6-(4-fluorophenyl)pyrazine;piperidin-4-ol.
What is the SMILES notation for 2-chloro-6-(4-fluorophenyl)pyrazine;piperidin-4-ol?
The canonical SMILES for 2-chloro-6-(4-fluorophenyl)pyrazine;piperidin-4-ol is Fc1ccc(-c2cncc(Cl)n2)cc1.OC1CCNCC1.
What is the InChIKey of 2-chloro-6-(4-fluorophenyl)pyrazine;piperidin-4-ol?
The InChIKey is ZCTBQPVKETUSJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClFN2.C5H11NO/c11-10-6-13-5-9(14-10)7-1-3-8(12)4-2-7;7-5-1-3-6-4-2-5/h1-6H;5-7H,1-4H2.
What are the key properties of 2-chloro-6-(4-fluorophenyl)pyrazine;piperidin-4-ol?
2-chloro-6-(4-fluorophenyl)pyrazine;piperidin-4-ol has a molecular weight of 309.77 g/mol, XLogP of 2.67, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-(4-fluorophenyl)pyrazine;piperidin-4-ol is sourced from PubChem (CID 175244850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).