About 2-pyridin-2-ylphenol;hydrate
2-pyridin-2-ylphenol;hydrate (PubChem CID 175244966) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-pyridin-2-ylphenol;hydrate.
Molecular Properties
| Compound Name | 2-pyridin-2-ylphenol;hydrate |
| PubChem CID | 175244966 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-pyridin-2-ylphenol;hydrate |
| SMILES | O.Oc1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C11H9NO.H2O/c13-11-7-2-1-5-9(11)10-6-3-4-8-12-10;/h1-8,13H;1H2 |
| InChIKey | HBMALUNNTJLVCA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-pyridin-2-ylphenol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylphenol;hydrate?
The IUPAC name of 2-pyridin-2-ylphenol;hydrate (CID 175244966) is 2-pyridin-2-ylphenol;hydrate.
What is the SMILES notation for 2-pyridin-2-ylphenol;hydrate?
The canonical SMILES for 2-pyridin-2-ylphenol;hydrate is O.Oc1ccccc1-c1ccccn1.
What is the InChIKey of 2-pyridin-2-ylphenol;hydrate?
The InChIKey is HBMALUNNTJLVCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO.H2O/c13-11-7-2-1-5-9(11)10-6-3-4-8-12-10;/h1-8,13H;1H2.
What are the key properties of 2-pyridin-2-ylphenol;hydrate?
2-pyridin-2-ylphenol;hydrate has a molecular weight of 189.21 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylphenol;hydrate is sourced from PubChem (CID 175244966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).