About N,N-dimethylmethanamine;pyrimidine-2,5-diamine
N,N-dimethylmethanamine;pyrimidine-2,5-diamine (PubChem CID 175245115) has the molecular formula C7H15N5
and a molecular weight of 169.23 g/mol. Its IUPAC name is N,N-dimethylmethanamine;pyrimidine-2,5-diamine.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;pyrimidine-2,5-diamine |
| PubChem CID | 175245115 |
| Molecular Formula | C7H15N5 |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | N,N-dimethylmethanamine;pyrimidine-2,5-diamine |
| SMILES | CN(C)C.Nc1cnc(N)nc1 |
| InChI | InChI=1S/C4H6N4.C3H9N/c5-3-1-7-4(6)8-2-3;1-4(2)3/h1-2H,5H2,(H2,6,7,8);1-3H3 |
| InChIKey | RATSUCFLWYHMKB-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-dimethylmethanamine;pyrimidine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;pyrimidine-2,5-diamine?
The IUPAC name of N,N-dimethylmethanamine;pyrimidine-2,5-diamine (CID 175245115) is N,N-dimethylmethanamine;pyrimidine-2,5-diamine.
What is the SMILES notation for N,N-dimethylmethanamine;pyrimidine-2,5-diamine?
The canonical SMILES for N,N-dimethylmethanamine;pyrimidine-2,5-diamine is CN(C)C.Nc1cnc(N)nc1.
What is the InChIKey of N,N-dimethylmethanamine;pyrimidine-2,5-diamine?
The InChIKey is RATSUCFLWYHMKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4.C3H9N/c5-3-1-7-4(6)8-2-3;1-4(2)3/h1-2H,5H2,(H2,6,7,8);1-3H3.
What are the key properties of N,N-dimethylmethanamine;pyrimidine-2,5-diamine?
N,N-dimethylmethanamine;pyrimidine-2,5-diamine has a molecular weight of 169.23 g/mol, XLogP of -0.18, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;pyrimidine-2,5-diamine is sourced from PubChem (CID 175245115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).