About 4-[2,4-diethoxy-4-[4-(trifluoromethyl)phenyl]butyl]sulfanyl-2-methylphenol
4-[2,4-diethoxy-4-[4-(trifluoromethyl)phenyl]butyl]sulfanyl-2-methylphenol (PubChem CID 175245928) has the molecular formula C22H27F3O3S
and a molecular weight of 428.52 g/mol. Its IUPAC name is 4-[2,4-diethoxy-4-[4-(trifluoromethyl)phenyl]butyl]sulfanyl-2-methylphenol.
Molecular Properties
| Compound Name | 4-[2,4-diethoxy-4-[4-(trifluoromethyl)phenyl]butyl]sulfanyl-2-methylphenol |
| PubChem CID | 175245928 |
| Molecular Formula | C22H27F3O3S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 4-[2,4-diethoxy-4-[4-(trifluoromethyl)phenyl]butyl]sulfanyl-2-methylphenol |
| SMILES | CCOC(CSc1ccc(O)c(C)c1)CC(OCC)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H27F3O3S/c1-4-27-18(14-29-19-10-11-20(26)15(3)12-19)13-21(28-5-2)16-6-8-17(9-7-16)22(23,24)25/h6-12,18,21,26H,4-5,13-14H2,1-3H3 |
| InChIKey | QQGLBRPOSGRSER-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2,4-diethoxy-4-[4-(trifluoromethyl)phenyl]butyl]sulfanyl-2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,4-diethoxy-4-[4-(trifluoromethyl)phenyl]butyl]sulfanyl-2-methylphenol?
The IUPAC name of 4-[2,4-diethoxy-4-[4-(trifluoromethyl)phenyl]butyl]sulfanyl-2-methylphenol (CID 175245928) is 4-[2,4-diethoxy-4-[4-(trifluoromethyl)phenyl]butyl]sulfanyl-2-methylphenol.
What is the SMILES notation for 4-[2,4-diethoxy-4-[4-(trifluoromethyl)phenyl]butyl]sulfanyl-2-methylphenol?
The canonical SMILES for 4-[2,4-diethoxy-4-[4-(trifluoromethyl)phenyl]butyl]sulfanyl-2-methylphenol is CCOC(CSc1ccc(O)c(C)c1)CC(OCC)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 4-[2,4-diethoxy-4-[4-(trifluoromethyl)phenyl]butyl]sulfanyl-2-methylphenol?
The InChIKey is QQGLBRPOSGRSER-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27F3O3S/c1-4-27-18(14-29-19-10-11-20(26)15(3)12-19)13-21(28-5-2)16-6-8-17(9-7-16)22(23,24)25/h6-12,18,21,26H,4-5,13-14H2,1-3H3.
What are the key properties of 4-[2,4-diethoxy-4-[4-(trifluoromethyl)phenyl]butyl]sulfanyl-2-methylphenol?
4-[2,4-diethoxy-4-[4-(trifluoromethyl)phenyl]butyl]sulfanyl-2-methylphenol has a molecular weight of 428.52 g/mol, XLogP of 6.38, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,4-diethoxy-4-[4-(trifluoromethyl)phenyl]butyl]sulfanyl-2-methylphenol is sourced from PubChem (CID 175245928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).