About sodium;2-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethenone;hydride
sodium;2-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethenone;hydride (PubChem CID 175246210) has the molecular formula C17H8Cl2F3NaO
and a molecular weight of 379.14 g/mol. Its IUPAC name is sodium;2-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethenone;hydride.
Molecular Properties
| Compound Name | sodium;2-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethenone;hydride |
| PubChem CID | 175246210 |
| Molecular Formula | C17H8Cl2F3NaO |
| Molecular Weight | 379.14 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | sodium;2-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethenone;hydride |
| SMILES | O=C=Cc1cc2c(Cl)cc(Cl)cc2c2cc(C(F)(F)F)ccc12.[H-].[Na+] |
| InChI | InChI=1S/C17H7Cl2F3O.Na.H/c18-11-7-14-13-6-10(17(20,21)22)1-2-12(13)9(3-4-23)5-15(14)16(19)8-11;;/h1-3,5-8H;;/q;+1;-1 |
| InChIKey | GOKORSZZEKMZAZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.14 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethenone;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethenone;hydride?
The IUPAC name of sodium;2-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethenone;hydride (CID 175246210) is sodium;2-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethenone;hydride.
What is the SMILES notation for sodium;2-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethenone;hydride?
The canonical SMILES for sodium;2-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethenone;hydride is O=C=Cc1cc2c(Cl)cc(Cl)cc2c2cc(C(F)(F)F)ccc12.[H-].[Na+].
What is the InChIKey of sodium;2-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethenone;hydride?
The InChIKey is GOKORSZZEKMZAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H7Cl2F3O.Na.H/c18-11-7-14-13-6-10(17(20,21)22)1-2-12(13)9(3-4-23)5-15(14)16(19)8-11;;/h1-3,5-8H;;/q;+1;-1.
What are the key properties of sodium;2-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethenone;hydride?
sodium;2-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethenone;hydride has a molecular weight of 379.14 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]ethenone;hydride is sourced from PubChem (CID 175246210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).