About 1,2,3-trinitrophenazine
1,2,3-trinitrophenazine (PubChem CID 175246743) has the molecular formula C12H5N5O6
and a molecular weight of 315.20 g/mol. Its IUPAC name is 1,2,3-trinitrophenazine.
Molecular Properties
| Compound Name | 1,2,3-trinitrophenazine |
| PubChem CID | 175246743 |
| Molecular Formula | C12H5N5O6 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 1,2,3-trinitrophenazine |
| SMILES | O=[N+]([O-])c1cc2nc3ccccc3nc2c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H5N5O6/c18-15(19)9-5-8-10(12(17(22)23)11(9)16(20)21)14-7-4-2-1-3-6(7)13-8/h1-5H |
| InChIKey | AQHXLGOOUGEDDH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 155.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-trinitrophenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trinitrophenazine?
The IUPAC name of 1,2,3-trinitrophenazine (CID 175246743) is 1,2,3-trinitrophenazine.
What is the SMILES notation for 1,2,3-trinitrophenazine?
The canonical SMILES for 1,2,3-trinitrophenazine is O=[N+]([O-])c1cc2nc3ccccc3nc2c([N+](=O)[O-])c1[N+](=O)[O-].
What is the InChIKey of 1,2,3-trinitrophenazine?
The InChIKey is AQHXLGOOUGEDDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5N5O6/c18-15(19)9-5-8-10(12(17(22)23)11(9)16(20)21)14-7-4-2-1-3-6(7)13-8/h1-5H.
What are the key properties of 1,2,3-trinitrophenazine?
1,2,3-trinitrophenazine has a molecular weight of 315.20 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trinitrophenazine is sourced from PubChem (CID 175246743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).