About 4-(10,15,20-triphenylporphyrin-5-yl)benzonitrile
4-(10,15,20-triphenylporphyrin-5-yl)benzonitrile (PubChem CID 175246960) has the molecular formula C45H27N5
and a molecular weight of 637.75 g/mol. Its IUPAC name is 4-(10,15,20-triphenylporphyrin-5-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-(10,15,20-triphenylporphyrin-5-yl)benzonitrile |
| PubChem CID | 175246960 |
| Molecular Formula | C45H27N5 |
| Molecular Weight | 637.75 g/mol |
| Exact Mass | 637.23 |
| IUPAC Name | 4-(10,15,20-triphenylporphyrin-5-yl)benzonitrile |
| SMILES | N#Cc1ccc(/C2=C3\C=CC(=N3)/C(c3ccccc3)=C3/C=CC(=N3)/C(c3ccccc3)=C3/C=CC(=N3)/C(c3ccccc3)=C3/C=CC2=N3)cc1 |
| InChI | InChI=1S/C45H27N5/c46-28-29-16-18-33(19-17-29)45-40-26-24-38(49-40)43(31-12-6-2-7-13-31)36-22-20-34(47-36)42(30-10-4-1-5-11-30)35-21-23-37(48-35)44(32-14-8-3-9-15-32)39-25-27-41(45)50-39/h1-27H/b42-34-,42-35-,43-36-,43-38-,44-37-,44-39-,45-40-,45-41- |
| InChIKey | PTDRKWXXFXWTDW-HIXPDHBDSA-N |
| XLogP | 9.56 |
| TPSA | 73.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 637.75 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(10,15,20-triphenylporphyrin-5-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(10,15,20-triphenylporphyrin-5-yl)benzonitrile?
The IUPAC name of 4-(10,15,20-triphenylporphyrin-5-yl)benzonitrile (CID 175246960) is 4-(10,15,20-triphenylporphyrin-5-yl)benzonitrile.
What is the SMILES notation for 4-(10,15,20-triphenylporphyrin-5-yl)benzonitrile?
The canonical SMILES for 4-(10,15,20-triphenylporphyrin-5-yl)benzonitrile is N#Cc1ccc(/C2=C3\C=CC(=N3)/C(c3ccccc3)=C3/C=CC(=N3)/C(c3ccccc3)=C3/C=CC(=N3)/C(c3ccccc3)=C3/C=CC2=N3)cc1.
What is the InChIKey of 4-(10,15,20-triphenylporphyrin-5-yl)benzonitrile?
The InChIKey is PTDRKWXXFXWTDW-HIXPDHBDSA-N. The full InChI is InChI=1S/C45H27N5/c46-28-29-16-18-33(19-17-29)45-40-26-24-38(49-40)43(31-12-6-2-7-13-31)36-22-20-34(47-36)42(30-10-4-1-5-11-30)35-21-23-37(48-35)44(32-14-8-3-9-15-32)39-25-27-41(45)50-39/h1-27H/b42-34-,42-35-,43-36-,43-38-,44-37-,44-39-,45-40-,45-41-.
What are the key properties of 4-(10,15,20-triphenylporphyrin-5-yl)benzonitrile?
4-(10,15,20-triphenylporphyrin-5-yl)benzonitrile has a molecular weight of 637.75 g/mol, XLogP of 9.56, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(10,15,20-triphenylporphyrin-5-yl)benzonitrile is sourced from PubChem (CID 175246960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).