2-[7-(3,5-dimethylphenyl)-2-methylindazol-3-yl]acetic acid

C18H18N2O2 — CID 175247176

IUPAC2-[7-(3,5-dimethylphenyl)-2-methylindazol-3-yl]acetic acid
SMILESCc1cc(C)cc(-c2cccc3c(CC(=O)O)n(C)nc23)c1
InChIInChI=1S/C18H18N2O2/c1-11-7-12(2)9-13(8-11)14-5-4-6-15-16(10-17(21)22)20(3)19-18(14)15/h4-9H,10H2,1-3H3,(H,21,22)
InChIKeyVMMAYAWYJBNGTD-UHFFFAOYSA-N
MW294.35 g/mol
LogP3.48
Rot. Bonds3

About 2-[7-(3,5-dimethylphenyl)-2-methylindazol-3-yl]acetic acid

2-[7-(3,5-dimethylphenyl)-2-methylindazol-3-yl]acetic acid (PubChem CID 175247176) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-[7-(3,5-dimethylphenyl)-2-methylindazol-3-yl]acetic acid.

Molecular Properties

Compound Name2-[7-(3,5-dimethylphenyl)-2-methylindazol-3-yl]acetic acid
PubChem CID175247176
Molecular FormulaC18H18N2O2
Molecular Weight294.35 g/mol
Exact Mass294.14
IUPAC Name2-[7-(3,5-dimethylphenyl)-2-methylindazol-3-yl]acetic acid
SMILESCc1cc(C)cc(-c2cccc3c(CC(=O)O)n(C)nc23)c1
InChIInChI=1S/C18H18N2O2/c1-11-7-12(2)9-13(8-11)14-5-4-6-15-16(10-17(21)22)20(3)19-18(14)15/h4-9H,10H2,1-3H3,(H,21,22)
InChIKeyVMMAYAWYJBNGTD-UHFFFAOYSA-N
XLogP3.48
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.35
LogP ≤ 53.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[7-(3,5-dimethylphenyl)-2-methylindazol-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[7-(3,5-dimethylphenyl)-2-methylindazol-3-yl]acetic acid?
The IUPAC name of 2-[7-(3,5-dimethylphenyl)-2-methylindazol-3-yl]acetic acid (CID 175247176) is 2-[7-(3,5-dimethylphenyl)-2-methylindazol-3-yl]acetic acid.
What is the SMILES notation for 2-[7-(3,5-dimethylphenyl)-2-methylindazol-3-yl]acetic acid?
The canonical SMILES for 2-[7-(3,5-dimethylphenyl)-2-methylindazol-3-yl]acetic acid is Cc1cc(C)cc(-c2cccc3c(CC(=O)O)n(C)nc23)c1.
What is the InChIKey of 2-[7-(3,5-dimethylphenyl)-2-methylindazol-3-yl]acetic acid?
The InChIKey is VMMAYAWYJBNGTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O2/c1-11-7-12(2)9-13(8-11)14-5-4-6-15-16(10-17(21)22)20(3)19-18(14)15/h4-9H,10H2,1-3H3,(H,21,22).
What are the key properties of 2-[7-(3,5-dimethylphenyl)-2-methylindazol-3-yl]acetic acid?
2-[7-(3,5-dimethylphenyl)-2-methylindazol-3-yl]acetic acid has a molecular weight of 294.35 g/mol, XLogP of 3.48, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7-(3,5-dimethylphenyl)-2-methylindazol-3-yl]acetic acid is sourced from PubChem (CID 175247176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).