C31H44O5 — CID 175247768
2-[(1S,2R,4aR,6aR,6aS,6bR,8aR,12aR,14bR)-9-formyl-1,2,6a,6b,9,12a-hexamethyl-10,11-dioxo-2,3,4,5,6,6a,7,8,8a,12,13,14b-dodecahydro-1H-picen-4a-yl]acetic acid (PubChem CID 175247768) has the molecular formula C31H44O5 and a molecular weight of 496.69 g/mol. Its IUPAC name is 2-[(1S,2R,4aR,6aR,6aS,6bR,8aR,12aR,14bR)-9-formyl-1,2,6a,6b,9,12a-hexamethyl-10,11-dioxo-2,3,4,5,6,6a,7,8,8a,12,13,14b-dodecahydro-1H-picen-4a-yl]acetic acid.
| Compound Name | 2-[(1S,2R,4aR,6aR,6aS,6bR,8aR,12aR,14bR)-9-formyl-1,2,6a,6b,9,12a-hexamethyl-10,11-dioxo-2,3,4,5,6,6a,7,8,8a,12,13,14b-dodecahydro-1H-picen-4a-yl]acetic acid |
|---|---|
| PubChem CID | 175247768 |
| Molecular Formula | C31H44O5 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | 2-[(1S,2R,4aR,6aR,6aS,6bR,8aR,12aR,14bR)-9-formyl-1,2,6a,6b,9,12a-hexamethyl-10,11-dioxo-2,3,4,5,6,6a,7,8,8a,12,13,14b-dodecahydro-1H-picen-4a-yl]acetic acid |
| SMILES | C[C@H]1[C@H](C)CC[C@]2(CC(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC(=O)C(=O)C(C)(C=O)[C@@H]5CC[C@]43C)[C@H]12 |
| InChI | InChI=1S/C31H44O5/c1-18-9-12-31(16-24(34)35)14-13-29(5)20(25(31)19(18)2)7-8-23-27(3)15-21(33)26(36)28(4,17-32)22(27)10-11-30(23,29)6/h7,17-19,22-23,25H,8-16H2,1-6H3,(H,34,35)/t18-,19+,22-,23-,25+,27+,28?,29-,30-,31-/m1/s1 |
| InChIKey | RTSSPPAQQSXXJG-WKWHSILHSA-N |
| XLogP | 6.05 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|