C22H42O12 — CID 175247790
(E)-but-2-enedioic acid;hexanedioic acid;bis(hexane-1,1-diol) (PubChem CID 175247790) has the molecular formula C22H42O12 and a molecular weight of 498.57 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;hexanedioic acid;bis(hexane-1,1-diol).
| Compound Name | (E)-but-2-enedioic acid;hexanedioic acid;bis(hexane-1,1-diol) |
|---|---|
| PubChem CID | 175247790 |
| Molecular Formula | C22H42O12 |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | (E)-but-2-enedioic acid;hexanedioic acid;bis(hexane-1,1-diol) |
| SMILES | CCCCCC(O)O.CCCCCC(O)O.O=C(O)/C=C/C(=O)O.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C6H10O4.2C6H14O2.C4H4O4/c7-5(8)3-1-2-4-6(9)10;2*1-2-3-4-5-6(7)8;5-3(6)1-2-4(7)8/h1-4H2,(H,7,8)(H,9,10);2*6-8H,2-5H2,1H3;1-2H,(H,5,6)(H,7,8)/b;;;2-1+ |
| InChIKey | WRXMRBILPROWAK-FFWMQHKVSA-N |
| XLogP | 2.18 |
| TPSA | 230.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|