About bis[1-(5-methylhexa-1,2-dien-3-yl)pyrrol-2-yl]methanone
bis[1-(5-methylhexa-1,2-dien-3-yl)pyrrol-2-yl]methanone (PubChem CID 175247797) has the molecular formula C23H28N2O
and a molecular weight of 348.49 g/mol. Its IUPAC name is bis[1-(5-methylhexa-1,2-dien-3-yl)pyrrol-2-yl]methanone.
Molecular Properties
| Compound Name | bis[1-(5-methylhexa-1,2-dien-3-yl)pyrrol-2-yl]methanone |
| PubChem CID | 175247797 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | bis[1-(5-methylhexa-1,2-dien-3-yl)pyrrol-2-yl]methanone |
| SMILES | C=C=C(CC(C)C)n1cccc1C(=O)c1cccn1C(=C=C)CC(C)C |
| InChI | InChI=1S/C23H28N2O/c1-7-19(15-17(3)4)24-13-9-11-21(24)23(26)22-12-10-14-25(22)20(8-2)16-18(5)6/h9-14,17-18H,1-2,15-16H2,3-6H3 |
| InChIKey | YUKJWSBVDARLPE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis[1-(5-methylhexa-1,2-dien-3-yl)pyrrol-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[1-(5-methylhexa-1,2-dien-3-yl)pyrrol-2-yl]methanone?
The IUPAC name of bis[1-(5-methylhexa-1,2-dien-3-yl)pyrrol-2-yl]methanone (CID 175247797) is bis[1-(5-methylhexa-1,2-dien-3-yl)pyrrol-2-yl]methanone.
What is the SMILES notation for bis[1-(5-methylhexa-1,2-dien-3-yl)pyrrol-2-yl]methanone?
The canonical SMILES for bis[1-(5-methylhexa-1,2-dien-3-yl)pyrrol-2-yl]methanone is C=C=C(CC(C)C)n1cccc1C(=O)c1cccn1C(=C=C)CC(C)C.
What is the InChIKey of bis[1-(5-methylhexa-1,2-dien-3-yl)pyrrol-2-yl]methanone?
The InChIKey is YUKJWSBVDARLPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O/c1-7-19(15-17(3)4)24-13-9-11-21(24)23(26)22-12-10-14-25(22)20(8-2)16-18(5)6/h9-14,17-18H,1-2,15-16H2,3-6H3.
What are the key properties of bis[1-(5-methylhexa-1,2-dien-3-yl)pyrrol-2-yl]methanone?
bis[1-(5-methylhexa-1,2-dien-3-yl)pyrrol-2-yl]methanone has a molecular weight of 348.49 g/mol, XLogP of 5.86, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis[1-(5-methylhexa-1,2-dien-3-yl)pyrrol-2-yl]methanone is sourced from PubChem (CID 175247797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).