C26H20F3NO4 — CID 175248347
methyl (Z)-3-(9H-fluoren-1-ylmethoxycarbonylamino)-4-(2,4,5-trifluorophenyl)but-2-enoate (PubChem CID 175248347) has the molecular formula C26H20F3NO4 and a molecular weight of 467.44 g/mol. Its IUPAC name is methyl (Z)-3-(9H-fluoren-1-ylmethoxycarbonylamino)-4-(2,4,5-trifluorophenyl)but-2-enoate.
| Compound Name | methyl (Z)-3-(9H-fluoren-1-ylmethoxycarbonylamino)-4-(2,4,5-trifluorophenyl)but-2-enoate |
|---|---|
| PubChem CID | 175248347 |
| Molecular Formula | C26H20F3NO4 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | methyl (Z)-3-(9H-fluoren-1-ylmethoxycarbonylamino)-4-(2,4,5-trifluorophenyl)but-2-enoate |
| SMILES | COC(=O)/C=C(/Cc1cc(F)c(F)cc1F)NC(=O)OCc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C26H20F3NO4/c1-33-25(31)12-18(9-17-11-23(28)24(29)13-22(17)27)30-26(32)34-14-16-6-4-8-20-19-7-3-2-5-15(19)10-21(16)20/h2-8,11-13H,9-10,14H2,1H3,(H,30,32)/b18-12- |
| InChIKey | XNVXIFKCNZVSJJ-PDGQHHTCSA-N |
| XLogP | 5.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|