About 1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-(trifluoromethyl)phenyl]urea
1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-(trifluoromethyl)phenyl]urea (PubChem CID 175248485) has the molecular formula C20H15F3N6O
and a molecular weight of 412.38 g/mol. Its IUPAC name is 1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-(trifluoromethyl)phenyl]urea.
Molecular Properties
| Compound Name | 1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-(trifluoromethyl)phenyl]urea |
| PubChem CID | 175248485 |
| Molecular Formula | C20H15F3N6O |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-(trifluoromethyl)phenyl]urea |
| SMILES | NC(=O)N(c1cccc(C#Cc2c(N)ncnc2N)c1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H15F3N6O/c21-20(22,23)15-6-1-2-7-16(15)29(19(26)30)13-5-3-4-12(10-13)8-9-14-17(24)27-11-28-18(14)25/h1-7,10-11H,(H2,26,30)(H4,24,25,27,28) |
| InChIKey | VSDHOLXHUSTEAD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-(trifluoromethyl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-(trifluoromethyl)phenyl]urea?
The IUPAC name of 1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-(trifluoromethyl)phenyl]urea (CID 175248485) is 1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-(trifluoromethyl)phenyl]urea.
What is the SMILES notation for 1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-(trifluoromethyl)phenyl]urea?
The canonical SMILES for 1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-(trifluoromethyl)phenyl]urea is NC(=O)N(c1cccc(C#Cc2c(N)ncnc2N)c1)c1ccccc1C(F)(F)F.
What is the InChIKey of 1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-(trifluoromethyl)phenyl]urea?
The InChIKey is VSDHOLXHUSTEAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F3N6O/c21-20(22,23)15-6-1-2-7-16(15)29(19(26)30)13-5-3-4-12(10-13)8-9-14-17(24)27-11-28-18(14)25/h1-7,10-11H,(H2,26,30)(H4,24,25,27,28).
What are the key properties of 1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-(trifluoromethyl)phenyl]urea?
1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-(trifluoromethyl)phenyl]urea has a molecular weight of 412.38 g/mol, XLogP of 3.28, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[2-(4,6-diaminopyrimidin-5-yl)ethynyl]phenyl]-1-[2-(trifluoromethyl)phenyl]urea is sourced from PubChem (CID 175248485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).