About N'-dimethylsilyl-N'-methylethane-1,2-diamine
N'-dimethylsilyl-N'-methylethane-1,2-diamine (PubChem CID 175248542) has the molecular formula C5H16N2Si
and a molecular weight of 132.28 g/mol. Its IUPAC name is N'-dimethylsilyl-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-dimethylsilyl-N'-methylethane-1,2-diamine |
| PubChem CID | 175248542 |
| Molecular Formula | C5H16N2Si |
| Molecular Weight | 132.28 g/mol |
| Exact Mass | 132.11 |
| IUPAC Name | N'-dimethylsilyl-N'-methylethane-1,2-diamine |
| SMILES | CN(CCN)[SiH](C)C |
| InChI | InChI=1S/C5H16N2Si/c1-7(5-4-6)8(2)3/h8H,4-6H2,1-3H3 |
| InChIKey | ZNINHRCLVWHWKU-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.28 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N'-dimethylsilyl-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-dimethylsilyl-N'-methylethane-1,2-diamine?
The IUPAC name of N'-dimethylsilyl-N'-methylethane-1,2-diamine (CID 175248542) is N'-dimethylsilyl-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-dimethylsilyl-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-dimethylsilyl-N'-methylethane-1,2-diamine is CN(CCN)[SiH](C)C.
What is the InChIKey of N'-dimethylsilyl-N'-methylethane-1,2-diamine?
The InChIKey is ZNINHRCLVWHWKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H16N2Si/c1-7(5-4-6)8(2)3/h8H,4-6H2,1-3H3.
What are the key properties of N'-dimethylsilyl-N'-methylethane-1,2-diamine?
N'-dimethylsilyl-N'-methylethane-1,2-diamine has a molecular weight of 132.28 g/mol, XLogP of -0.14, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-dimethylsilyl-N'-methylethane-1,2-diamine is sourced from PubChem (CID 175248542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).