C19H18F3N3OS — CID 175249283
N-(4-ethyl-1,3-thiazol-2-yl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide (PubChem CID 175249283) has the molecular formula C19H18F3N3OS and a molecular weight of 393.43 g/mol. Its IUPAC name is N-(4-ethyl-1,3-thiazol-2-yl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | N-(4-ethyl-1,3-thiazol-2-yl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 175249283 |
| Molecular Formula | C19H18F3N3OS |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-(4-ethyl-1,3-thiazol-2-yl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| SMILES | CCc1csc(NC(=O)c2cc(C)n(-c3ccccc3C(F)(F)F)c2C)n1 |
| InChI | InChI=1S/C19H18F3N3OS/c1-4-13-10-27-18(23-13)24-17(26)14-9-11(2)25(12(14)3)16-8-6-5-7-15(16)19(20,21)22/h5-10H,4H2,1-3H3,(H,23,24,26) |
| InChIKey | IMZRSLWIKFCFEC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|