C10H16N4 — CID 175250271
guanidine;1,2,3,4-tetrahydroisoquinoline (PubChem CID 175250271) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is guanidine;1,2,3,4-tetrahydroisoquinoline.
| Compound Name | guanidine;1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 175250271 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | guanidine;1,2,3,4-tetrahydroisoquinoline |
| SMILES | [H]N=C(N)N.c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C9H11N.CH5N3/c1-2-4-9-7-10-6-5-8(9)3-1;2-1(3)4/h1-4,10H,5-7H2;(H5,2,3,4) |
| InChIKey | VYRRWSGVCVSGDH-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 87.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|