C10H11ClFNO2 — CID 175250300
[(3S)-7-fluoro-1,2,3,4-tetrahydroisoquinolin-3-yl] formate;hydrochloride (PubChem CID 175250300) has the molecular formula C10H11ClFNO2 and a molecular weight of 231.65 g/mol. Its IUPAC name is [(3S)-7-fluoro-1,2,3,4-tetrahydroisoquinolin-3-yl] formate;hydrochloride.
| Compound Name | [(3S)-7-fluoro-1,2,3,4-tetrahydroisoquinolin-3-yl] formate;hydrochloride |
|---|---|
| PubChem CID | 175250300 |
| Molecular Formula | C10H11ClFNO2 |
| Molecular Weight | 231.65 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | [(3S)-7-fluoro-1,2,3,4-tetrahydroisoquinolin-3-yl] formate;hydrochloride |
| SMILES | Cl.O=CO[C@H]1Cc2ccc(F)cc2CN1 |
| InChI | InChI=1S/C10H10FNO2.ClH/c11-9-2-1-7-4-10(14-6-13)12-5-8(7)3-9;/h1-3,6,10,12H,4-5H2;1H/t10-;/m0./s1 |
| InChIKey | IGSDMAFLHAZLRT-PPHPATTJSA-N |
| XLogP | 1.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.65 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|