About 6-diazo-2-propylcyclohexa-1,3-diene;pentan-3-one
6-diazo-2-propylcyclohexa-1,3-diene;pentan-3-one (PubChem CID 175250996) has the molecular formula C14H22N2O
and a molecular weight of 234.34 g/mol. Its IUPAC name is 6-diazo-2-propylcyclohexa-1,3-diene;pentan-3-one.
Molecular Properties
| Compound Name | 6-diazo-2-propylcyclohexa-1,3-diene;pentan-3-one |
| PubChem CID | 175250996 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 6-diazo-2-propylcyclohexa-1,3-diene;pentan-3-one |
| SMILES | CCC(=O)CC.CCCC1=CC(=[N+]=[N-])CC=C1 |
| InChI | InChI=1S/C9H12N2.C5H10O/c1-2-4-8-5-3-6-9(7-8)11-10;1-3-5(6)4-2/h3,5,7H,2,4,6H2,1H3;3-4H2,1-2H3 |
| InChIKey | ODWWBHMZGZSCLI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-diazo-2-propylcyclohexa-1,3-diene;pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-diazo-2-propylcyclohexa-1,3-diene;pentan-3-one?
The IUPAC name of 6-diazo-2-propylcyclohexa-1,3-diene;pentan-3-one (CID 175250996) is 6-diazo-2-propylcyclohexa-1,3-diene;pentan-3-one.
What is the SMILES notation for 6-diazo-2-propylcyclohexa-1,3-diene;pentan-3-one?
The canonical SMILES for 6-diazo-2-propylcyclohexa-1,3-diene;pentan-3-one is CCC(=O)CC.CCCC1=CC(=[N+]=[N-])CC=C1.
What is the InChIKey of 6-diazo-2-propylcyclohexa-1,3-diene;pentan-3-one?
The InChIKey is ODWWBHMZGZSCLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2.C5H10O/c1-2-4-8-5-3-6-9(7-8)11-10;1-3-5(6)4-2/h3,5,7H,2,4,6H2,1H3;3-4H2,1-2H3.
What are the key properties of 6-diazo-2-propylcyclohexa-1,3-diene;pentan-3-one?
6-diazo-2-propylcyclohexa-1,3-diene;pentan-3-one has a molecular weight of 234.34 g/mol, XLogP of 3.72, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-diazo-2-propylcyclohexa-1,3-diene;pentan-3-one is sourced from PubChem (CID 175250996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).