About ethenol;trimethoxysilane
ethenol;trimethoxysilane (PubChem CID 175251073) has the molecular formula C5H14O4Si
and a molecular weight of 166.25 g/mol. Its IUPAC name is ethenol;trimethoxysilane.
Molecular Properties
| Compound Name | ethenol;trimethoxysilane |
| PubChem CID | 175251073 |
| Molecular Formula | C5H14O4Si |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | ethenol;trimethoxysilane |
| SMILES | C=CO.CO[SiH](OC)OC |
| InChI | InChI=1S/C3H10O3Si.C2H4O/c1-4-7(5-2)6-3;1-2-3/h7H,1-3H3;2-3H,1H2 |
| InChIKey | DWFFPOKXFJZTAN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenol;trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenol;trimethoxysilane?
The IUPAC name of ethenol;trimethoxysilane (CID 175251073) is ethenol;trimethoxysilane.
What is the SMILES notation for ethenol;trimethoxysilane?
The canonical SMILES for ethenol;trimethoxysilane is C=CO.CO[SiH](OC)OC.
What is the InChIKey of ethenol;trimethoxysilane?
The InChIKey is DWFFPOKXFJZTAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10O3Si.C2H4O/c1-4-7(5-2)6-3;1-2-3/h7H,1-3H3;2-3H,1H2.
What are the key properties of ethenol;trimethoxysilane?
ethenol;trimethoxysilane has a molecular weight of 166.25 g/mol, XLogP of 0.33, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenol;trimethoxysilane is sourced from PubChem (CID 175251073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).